smilesgeneratortest.java
来自「化学图形处理软件」· Java 代码 · 共 1,067 行 · 第 1/2 页
JAVA
1,067 行
/* $Revision: 6067 $ $Author: egonw $ $Date: 2006-04-21 10:59:31 +0200 (Fri, 21 Apr 2006) $ * * Copyright (C) 1997-2007 Christoph Steinbeck <steinbeck@users.sf.net> * * Contact: cdk-devel@lists.sourceforge.net * * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU Lesser General Public License * as published by the Free Software Foundation; either version 2.1 * of the License, or (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU Lesser General Public License for more details. * * You should have received a copy of the GNU Lesser General Public License * along with this program; if not, write to the Free Software * Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. */package org.openscience.cdk.test.gui.smiles;import java.io.IOException;import java.io.InputStream;import javax.vecmath.Point2d;import javax.vecmath.Vector2d;import junit.framework.Test;import junit.framework.TestSuite;import org.openscience.cdk.Atom;import org.openscience.cdk.AtomContainer;import org.openscience.cdk.CDKConstants;import org.openscience.cdk.Molecule;import org.openscience.cdk.PseudoAtom;import org.openscience.cdk.Reaction;import org.openscience.cdk.applications.swing.MoleculeViewer2D;import org.openscience.cdk.config.IsotopeFactory;import org.openscience.cdk.graph.AtomContainerAtomPermutor;import org.openscience.cdk.graph.AtomContainerBondPermutor;import org.openscience.cdk.io.MDLReader;import org.openscience.cdk.layout.HydrogenPlacer;import org.openscience.cdk.layout.StructureDiagramGenerator;import org.openscience.cdk.renderer.Renderer2DModel;import org.openscience.cdk.smiles.SmilesGenerator;import org.openscience.cdk.templates.MoleculeFactory;import org.openscience.cdk.test.CDKTestCase;import org.openscience.cdk.tools.HydrogenAdder;import org.openscience.cdk.tools.manipulator.AtomContainerManipulator;/** *@author steinbeck *@cdk.created February 9, 2004 *@cdk.module test-gui-smiles */public class SmilesGeneratorTest extends CDKTestCase{ boolean standAlone = false; public SmilesGeneratorTest(String name) { super(name); } /** * A unit test suite for JUnit * *@return The test suite */ public static Test suite() { return new TestSuite(SmilesGeneratorTest.class); } /** * Sets the standAlone attribute of the SmilesGeneratorTest object * *@param standAlone The new standAlone value */ public void setStandAlone(boolean standAlone) { this.standAlone = standAlone; } /** * A unit test for JUnit */ public void testSmilesGenerator() { Molecule mol2 = MoleculeFactory.makeAlphaPinene(); SmilesGenerator sg = new SmilesGenerator(); fixCarbonHCount(mol2); String smiles2 = null; if (standAlone) { display(mol2); } try { smiles2 = sg.createSMILES(mol2); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } if (standAlone) { System.err.println("SMILES 2: " + smiles2); } assertNotNull(smiles2); assertTrue(smiles2.equals("C1=C(C)C2CC(C1)C2(C)(C)")); } /** * A unit test for JUnit */ public void testEthylPropylPhenantren() { Molecule mol1 = MoleculeFactory.makeEthylPropylPhenantren(); SmilesGenerator sg = new SmilesGenerator(); fixCarbonHCount(mol1); String smiles1 = null; if (standAlone) { display(mol1); } try { smiles1 = sg.createSMILES(mol1); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } if (standAlone) { System.err.println("SMILES 1: " + smiles1); } assertNotNull(smiles1); assertTrue(smiles1.equals("c2cc1c3ccc(cc3(ccc1c(c2)CC))CCC")); } /** * A unit test for JUnit */ public void testPropylCycloPropane() { Molecule mol1 = MoleculeFactory.makePropylCycloPropane(); SmilesGenerator sg = new SmilesGenerator(); fixCarbonHCount(mol1); String smiles1 = null; if (standAlone) { display(mol1); } try { smiles1 = sg.createSMILES(mol1); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } if (standAlone) { System.err.println("SMILES 1: " + smiles1); } assertNotNull(smiles1); assertTrue(smiles1.equals("CCCC1CC1")); } /** * A unit test for JUnit * */ public void testAlanin() { HydrogenPlacer hydrogenPlacer = new HydrogenPlacer(); Molecule mol1 = new Molecule(); SmilesGenerator sg = new SmilesGenerator(); mol1.addAtom(new Atom("N", new Point2d(1, 0))); // 1 mol1.addAtom(new Atom("C", new Point2d(1, 2))); // 2 mol1.addAtom(new Atom("F", new Point2d(1, 2))); // 3 mol1.addAtom(new Atom("C", new Point2d(0, 0))); // 4 mol1.addAtom(new Atom("C", new Point2d(1, 4))); // 5 mol1.addAtom(new Atom("O", new Point2d(1, 5))); // 6 mol1.addAtom(new Atom("O", new Point2d(1, 6))); // 7 mol1.addBond(0, 1, 1); // 1 mol1.addBond(1, 2, 1, CDKConstants.STEREO_BOND_UP); // 2 mol1.addBond(1, 3, 1, CDKConstants.STEREO_BOND_DOWN); // 3 mol1.addBond(1, 4, 1); // 4 mol1.addBond(4, 5, 1); // 5 mol1.addBond(4, 6, 2); // 6 try { new HydrogenAdder().addHydrogensToSatisfyValency(mol1); hydrogenPlacer.placeHydrogens2D(mol1, 1.0); IsotopeFactory ifac = IsotopeFactory.getInstance(mol1.getBuilder()); ifac.configureAtoms(mol1); } catch (Exception ex) { fail(); } String smiles1 = null; if (standAlone) { display(mol1); } try { smiles1 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } if (standAlone) { System.err.println("SMILES 1: " + smiles1); } assertNotNull(smiles1); assertTrue(smiles1.equals("[H]OC(=O)[C@](F)(N([H])[H])C([H])([H])[H]")); mol1.getBond(1).setStereo(CDKConstants.STEREO_BOND_DOWN); mol1.getBond(2).setStereo(CDKConstants.STEREO_BOND_UP); try { smiles1 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } if (standAlone) { System.err.println("SMILES 1: " + smiles1); } assertNotNull(smiles1); assertTrue(smiles1.equals("[H]OC(=O)[C@](F)(C([H])([H])[H])N([H])[H]")); } /** * A unit test for JUnit */ public void testCisResorcinol() throws Exception { HydrogenPlacer hydrogenPlacer = new HydrogenPlacer(); Molecule mol1 = new Molecule(); SmilesGenerator sg = new SmilesGenerator(); mol1.addAtom(new Atom("O", new Point2d(3, 1))); // 1 mol1.addAtom(new Atom("H", new Point2d(2, 0))); // 2 mol1.addAtom(new Atom("C", new Point2d(2, 1))); // 3 mol1.addAtom(new Atom("C", new Point2d(1, 1))); // 4 mol1.addAtom(new Atom("C", new Point2d(1, 4))); // 5 mol1.addAtom(new Atom("C", new Point2d(1, 5))); // 6 mol1.addAtom(new Atom("C", new Point2d(1, 2))); // 7 mol1.addAtom(new Atom("C", new Point2d(2, 2))); // 1 mol1.addAtom(new Atom("O", new Point2d(3, 2))); // 2 mol1.addAtom(new Atom("H", new Point2d(2, 3))); // 3 mol1.addBond(0, 2, 1, CDKConstants.STEREO_BOND_DOWN); // 1 mol1.addBond(1, 2, 1, CDKConstants.STEREO_BOND_UP); // 2 mol1.addBond(2, 3, 1); // 3 mol1.addBond(3, 4, 1); // 4 mol1.addBond(4, 5, 1); // 5 mol1.addBond(5, 6, 1); // 6 mol1.addBond(6, 7, 1); // 3 mol1.addBond(7, 8, 1, CDKConstants.STEREO_BOND_UP); // 4 mol1.addBond(7, 9, 1, CDKConstants.STEREO_BOND_DOWN); // 5 mol1.addBond(7, 2, 1); // 6 try { new HydrogenAdder().addHydrogensToSatisfyValency(mol1); hydrogenPlacer.placeHydrogens2D(mol1, 1.0); IsotopeFactory ifac = IsotopeFactory.getInstance(mol1.getBuilder()); ifac.configureAtoms(mol1); } catch (IOException ex) { } catch (ClassNotFoundException ex) { } String smiles1 = null; if (standAlone) { display(mol1); } try { smiles1 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } if (standAlone) { System.err.println("SMILES 1: " + smiles1); } assertNotNull(smiles1); assertTrue(smiles1.equals("[H]O[C@]1(C([H])([H])C([H])([H])C([H])([H])C([H])([H])[C@]1(O[H])([H]))([H])")); mol1 = (Molecule) AtomContainerManipulator.removeHydrogens(mol1); try { smiles1 = sg.createSMILES(mol1); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } if (standAlone) { System.err.println("SMILES 1: " + smiles1); } assertNotNull(smiles1); assertTrue(smiles1.equals("OC1CCCCC1(O)")); } /** * A unit test for JUnit */ public void testCisTransDecalin() throws Exception { HydrogenPlacer hydrogenPlacer = new HydrogenPlacer(); Molecule mol1 = new Molecule(); SmilesGenerator sg = new SmilesGenerator(); mol1.addAtom(new Atom("H", new Point2d(1, 0))); // 1 mol1.addAtom(new Atom("C", new Point2d(1, 2))); // 2 mol1.addAtom(new Atom("C", new Point2d(1, 2))); // 3 mol1.addAtom(new Atom("C", new Point2d(0, 0))); // 4 mol1.addAtom(new Atom("C", new Point2d(1, 4))); // 5 mol1.addAtom(new Atom("C", new Point2d(1, 5))); // 6 mol1.addAtom(new Atom("C", new Point2d(1, 6))); // 7 mol1.addAtom(new Atom("H", new Point2d(1, 0))); // 1 mol1.addAtom(new Atom("C", new Point2d(1, 2))); // 2 mol1.addAtom(new Atom("C", new Point2d(1, 2))); // 3 mol1.addAtom(new Atom("C", new Point2d(1, 2))); // 2 mol1.addAtom(new Atom("C", new Point2d(1, 2))); // 3 mol1.addBond(0, 1, 1, CDKConstants.STEREO_BOND_DOWN); // 1 mol1.addBond(1, 2, 1); // 2 mol1.addBond(2, 3, 1); // 3 mol1.addBond(3, 4, 1); // 4 mol1.addBond(4, 5, 1); // 5 mol1.addBond(5, 6, 1); // 6 mol1.addBond(6, 7, 1, CDKConstants.STEREO_BOND_DOWN); // 3 mol1.addBond(6, 8, 1); // 4 mol1.addBond(8, 9, 1); // 5 mol1.addBond(9, 10, 1); // 6 mol1.addBond(10, 11, 1); // 6 mol1.addBond(11, 1, 1); // 6 mol1.addBond(1, 6, 1); // 6 try { new HydrogenAdder().addHydrogensToSatisfyValency(mol1); hydrogenPlacer.placeHydrogens2D(mol1, 1.0); IsotopeFactory ifac = IsotopeFactory.getInstance(mol1.getBuilder()); ifac.configureAtoms(mol1); } catch (IOException ex) { } catch (ClassNotFoundException ex) { } String smiles1 = null; if (standAlone) { display(mol1); } try { smiles1 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } if (standAlone) { System.err.println("SMILES 1: " + smiles1); } assertNotNull(smiles1); assertTrue(smiles1.equals("[H]C1([H])(C([H])([H])C([H])([H])C\\2([H])(C([H])([H])C([H])([H])C([H])([H])C([H])([H])C\\2([H])(C1([H])([H]))))")); mol1.getBond(6).setStereo(CDKConstants.STEREO_BOND_UP); String smiles3 = null; try { smiles3 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]); } catch (Exception exc) { System.out.println(exc); if (!standAlone) { fail(); } } assertFalse(smiles1.equals(smiles3)); } /** * A unit test for JUnit */ public void testDoubleBondConfiguration() throws Exception { HydrogenPlacer hydrogenPlacer = new HydrogenPlacer(); Molecule mol1 = new Molecule(); SmilesGenerator sg = new SmilesGenerator(); mol1.addAtom(new Atom("S", new Point2d(0, 0))); // 1 mol1.addAtom(new Atom("C", new Point2d(1, 1))); // 2 mol1.addAtom(new Atom("F", new Point2d(2, 0))); // 3 mol1.addAtom(new Atom("C", new Point2d(1, 2))); // 4 mol1.addAtom(new Atom("F", new Point2d(2, 3))); // 5 mol1.addAtom(new Atom("S", new Point2d(0, 3))); // 1 mol1.addBond(0, 1, 1); // 1 mol1.addBond(1, 2, 1); // 2 mol1.addBond(1, 3, 2); // 3 mol1.addBond(3, 4, 1); // 4 mol1.addBond(3, 5, 1); // 4 try { IsotopeFactory ifac = IsotopeFactory.getInstance(mol1.getBuilder()); ifac.configureAtoms(mol1); } catch (IOException ex) { } String smiles1 = null; if (standAlone) { display(mol1); } boolean[] bool = new boolean[mol1.getBondCount()]; bool[2] = true;
⌨️ 快捷键说明
复制代码Ctrl + C
搜索代码Ctrl + F
全屏模式F11
增大字号Ctrl + =
减小字号Ctrl + -
显示快捷键?