deducebondordertestfromexplicithydrogens.java

来自「化学图形处理软件」· Java 代码 · 共 424 行

JAVA
424
字号
/* $Revision: 6707 $ $Author: egonw $ $Date: 2006-07-30 22:38:18 +0200 (Sun, 30 Jul 2006) $ * * Copyright (C) 2006-2007  Egon Willighagen <egonw@users.sf.net> * * Contact: cdk-devel@lists.sourceforge.net * * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU Lesser General Public License * as published by the Free Software Foundation; either version 2.1 * of the License, or (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the * GNU Lesser General Public License for more details. * * You should have received a copy of the GNU Lesser General Public License * along with this program; if not, write to the Free Software * Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. */package org.openscience.cdk.test.tools;import junit.framework.Test;import junit.framework.TestSuite;import org.openscience.cdk.CDKConstants;import org.openscience.cdk.config.Elements;import org.openscience.cdk.interfaces.IAtom;import org.openscience.cdk.interfaces.IAtomContainer;import org.openscience.cdk.interfaces.IBond;import org.openscience.cdk.interfaces.IMolecule;import org.openscience.cdk.nonotify.NNAtom;import org.openscience.cdk.nonotify.NNBond;import org.openscience.cdk.nonotify.NNMolecule;import org.openscience.cdk.test.CDKTestCase;import org.openscience.cdk.tools.IDeduceBondOrderTool;import org.openscience.cdk.tools.SaturationChecker;/** * Test suite for testing deduce-bond-order implementations. * This suite tests deduction from hybridization rich starting * points, excluding, but optional, implicit or explicit * hydrogen counts. *  * @author      egonw * @cdk.module  test-valencycheck * @cdk.created 2006-08-16 */public class DeduceBondOrderTestFromExplicitHydrogens extends CDKTestCase {		private IDeduceBondOrderTool dboTool;	public DeduceBondOrderTestFromExplicitHydrogens(String name) {		super(name);	}	public void setUp() throws Exception {		dboTool = new SaturationChecker();	}	public static Test suite() {		return new TestSuite(DeduceBondOrderTestFromExplicitHydrogens.class);	}	/**	 * Test <div class="inchi">InChI=1/C2H2/c1-2/h1-2H</div>. 	 */	public void testAcetylene() throws Exception {		IMolecule keto = new NNMolecule();				// atom block		IAtom atom1 = new NNAtom(Elements.CARBON);		addHydrogens(keto, atom1, 1);		IAtom atom2 = new NNAtom(Elements.CARBON);		addHydrogens(keto, atom2, 1);				// bond block		IBond bond1 = new NNBond(atom1, atom2);				keto.addAtom(atom1);		keto.addAtom(atom2);		keto.addBond(bond1);				// now have the algorithm have a go at it		dboTool.saturate(keto);				// now check wether it did the right thing		assertEquals(CDKConstants.BONDORDER_TRIPLE, bond1.getOrder(), 0.00001);	}	/**	 * Test <div class="inchi">InChI=1/C2H4O/c1-2-3/h2H,1H3</div>. 	 */	public void testKeto() throws Exception {		IMolecule keto = new NNMolecule();				// atom block		IAtom atom1 = new NNAtom(Elements.CARBON);		addHydrogens(keto, atom1, 3);		IAtom atom2 = new NNAtom(Elements.CARBON);		addHydrogens(keto, atom2, 1);		IAtom atom3 = new NNAtom(Elements.OXYGEN);				// bond block		IBond bond1 = new NNBond(atom1, atom2);		IBond bond2 = new NNBond(atom2, atom3);				keto.addAtom(atom1);		keto.addAtom(atom2);		keto.addAtom(atom3);		keto.addBond(bond1);		keto.addBond(bond2);				// now have the algorithm have a go at it		dboTool.saturate(keto);				// now check wether it did the right thing		assertEquals(CDKConstants.BONDORDER_SINGLE, bond1.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_DOUBLE, bond2.getOrder(), 0.00001);	}		/**	 * Test <div class="inchi">InChI=1/C2H6O/c1-2-3/h3H,2H2,1H3</div>. 	 */	public void testEnol() throws Exception {		IMolecule enol = new NNMolecule();				// atom block		IAtom atom1 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom1, 2);		IAtom atom2 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom2, 1);		IAtom atom3 = new NNAtom(Elements.OXYGEN);		addHydrogens(enol, atom3, 1);				// bond block		IBond bond1 = new NNBond(atom1, atom2);		IBond bond2 = new NNBond(atom2, atom3);				enol.addAtom(atom1);		enol.addAtom(atom2);		enol.addAtom(atom3);		enol.addBond(bond1);		enol.addBond(bond2);				// now have the algorithm have a go at it		dboTool.saturate(enol);				// now check wether it did the right thing		assertEquals(CDKConstants.BONDORDER_DOUBLE, bond1.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_SINGLE, bond2.getOrder(), 0.00001);	}		/**	 * Test <div class="inchi">InChI=1/C4H6/c1-3-4-2/h3-4H,1-2H2</div>. 	 */	public void xtestButadiene() throws Exception {		IMolecule enol = new NNMolecule();				// atom block		IAtom atom1 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom1, 2);		IAtom atom2 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom2, 1);		IAtom atom3 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom3, 1);		IAtom atom4 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom4, 2);				// bond block		IBond bond1 = new NNBond(atom1, atom2);		IBond bond2 = new NNBond(atom2, atom3);		IBond bond3 = new NNBond(atom3, atom4);				enol.addAtom(atom1);		enol.addAtom(atom2);		enol.addAtom(atom3);		enol.addAtom(atom4);		enol.addBond(bond1);		enol.addBond(bond2);		enol.addBond(bond3);				// now have the algorithm have a go at it		dboTool.saturate(enol);				// now check wether it did the right thing		assertEquals(CDKConstants.BONDORDER_DOUBLE, bond1.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_SINGLE, bond2.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_SINGLE, bond3.getOrder(), 0.00001);	}	/**	 * Test <div class="inchi">InChI=1/C6H4O2/c7-5-1-2-6(8)4-3-5/h1-4H</div>. 	 */	public void testQuinone() throws Exception {		IMolecule enol = new NNMolecule();				// atom block		IAtom atom1 = new NNAtom(Elements.CARBON);		IAtom atom2 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom2, 1);		IAtom atom3 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom3, 1);		IAtom atom4 = new NNAtom(Elements.CARBON);		IAtom atom5 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom5, 1);		IAtom atom6 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom6, 1);		IAtom atom7 = new NNAtom(Elements.OXYGEN);		IAtom atom8 = new NNAtom(Elements.OXYGEN);				// bond block		IBond bond1 = new NNBond(atom1, atom2);		IBond bond2 = new NNBond(atom2, atom3);		IBond bond3 = new NNBond(atom3, atom4);		IBond bond4 = new NNBond(atom4, atom5);		IBond bond5 = new NNBond(atom5, atom6);		IBond bond6 = new NNBond(atom6, atom1);		IBond bond7 = new NNBond(atom7, atom1);		IBond bond8 = new NNBond(atom8, atom4);				enol.addAtom(atom1);		enol.addAtom(atom2);		enol.addAtom(atom3);		enol.addAtom(atom4);		enol.addAtom(atom5);		enol.addAtom(atom6);		enol.addAtom(atom7);		enol.addAtom(atom8);		enol.addBond(bond1);		enol.addBond(bond2);		enol.addBond(bond3);		enol.addBond(bond4);		enol.addBond(bond5);		enol.addBond(bond6);		enol.addBond(bond7);		enol.addBond(bond8);				// now have the algorithm have a go at it		dboTool.saturate(enol);				// now check wether it did the right thing		assertEquals(CDKConstants.BONDORDER_SINGLE, bond1.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_DOUBLE, bond2.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_SINGLE, bond3.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_SINGLE, bond4.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_DOUBLE, bond5.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_SINGLE, bond6.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_DOUBLE, bond7.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_DOUBLE, bond8.getOrder(), 0.00001);	}		/**	 * Test <div class="inchi">InChI=1/C6H6/c1-2-4-6-5-3-1/h1-6H</div>. 	 */	public void testBenzene() throws Exception {		IMolecule enol = new NNMolecule();				// atom block		IAtom atom1 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom1, 1);		IAtom atom2 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom2, 1);		IAtom atom3 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom3, 1);		IAtom atom4 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom4, 1);		IAtom atom5 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom5, 1);		IAtom atom6 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom6, 1);				// bond block		IBond bond1 = new NNBond(atom1, atom2);		IBond bond2 = new NNBond(atom2, atom3);		IBond bond3 = new NNBond(atom3, atom4);		IBond bond4 = new NNBond(atom4, atom5);		IBond bond5 = new NNBond(atom5, atom6);		IBond bond6 = new NNBond(atom6, atom1);				enol.addAtom(atom1);		enol.addAtom(atom2);		enol.addAtom(atom3);		enol.addAtom(atom4);		enol.addAtom(atom5);		enol.addAtom(atom6);		enol.addBond(bond1);		enol.addBond(bond2);		enol.addBond(bond3);		enol.addBond(bond4);		enol.addBond(bond5);		enol.addBond(bond6);				// now have the algorithm have a go at it		dboTool.saturate(enol);				// now check wether it did the right thing		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond1.getOrder() + bond6.getOrder(), 0.00001); // around atom1		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond1.getOrder() + bond2.getOrder(), 0.00001); // around atom2		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond2.getOrder() + bond3.getOrder(), 0.00001); // around atom3		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond3.getOrder() + bond4.getOrder(), 0.00001); // around atom4		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond4.getOrder() + bond5.getOrder(), 0.00001); // around atom5		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond5.getOrder() + bond6.getOrder(), 0.00001); // around atom6	}		/**	 * Test <div class="inchi">InChI=1/C4H5N/c1-2-4-5-3-1/h1-5H</div>. 	 */	public void testPyrrole() throws Exception {		IMolecule enol = new NNMolecule();				// atom block		IAtom atom1 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom1, 1);		IAtom atom2 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom2, 1);		IAtom atom3 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom3, 1);		IAtom atom4 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom4, 1);		IAtom atom5 = new NNAtom(Elements.NITROGEN);		addHydrogens(enol, atom5, 1);				// bond block		IBond bond1 = new NNBond(atom1, atom2);		IBond bond2 = new NNBond(atom2, atom3);		IBond bond3 = new NNBond(atom3, atom4);		IBond bond4 = new NNBond(atom4, atom5);		IBond bond5 = new NNBond(atom5, atom1);				enol.addAtom(atom1);		enol.addAtom(atom2);		enol.addAtom(atom3);		enol.addAtom(atom4);		enol.addAtom(atom5);		enol.addBond(bond1);		enol.addBond(bond2);		enol.addBond(bond3);		enol.addBond(bond4);		enol.addBond(bond5);				// now have the algorithm have a go at it		dboTool.saturate(enol);				// now check wether it did the right thing		assertEquals(CDKConstants.BONDORDER_DOUBLE, bond1.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_SINGLE, bond2.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_DOUBLE, bond3.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_SINGLE, bond4.getOrder(), 0.00001);		assertEquals(CDKConstants.BONDORDER_SINGLE, bond5.getOrder(), 0.00001);	}		/**	 * Test <div class="inchi">InChI=1/C5H5N/c1-2-4-6-5-3-1/h1-5H</div>. 	 */	public void xtestPyridine() throws Exception {		IMolecule enol = new NNMolecule();				// atom block		IAtom atom1 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom1, 1);		IAtom atom2 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom2, 1);		IAtom atom3 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom3, 1);		IAtom atom4 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom4, 1);		IAtom atom5 = new NNAtom(Elements.NITROGEN);		IAtom atom6 = new NNAtom(Elements.CARBON);		addHydrogens(enol, atom6, 1);				// bond block		IBond bond1 = new NNBond(atom1, atom2);		IBond bond2 = new NNBond(atom2, atom3);		IBond bond3 = new NNBond(atom3, atom4);		IBond bond4 = new NNBond(atom4, atom5);		IBond bond5 = new NNBond(atom5, atom6);		IBond bond6 = new NNBond(atom6, atom1);				enol.addAtom(atom1);		enol.addAtom(atom2);		enol.addAtom(atom3);		enol.addAtom(atom4);		enol.addAtom(atom5);		enol.addAtom(atom6);		enol.addBond(bond1);		enol.addBond(bond2);		enol.addBond(bond3);		enol.addBond(bond4);		enol.addBond(bond5);		enol.addBond(bond6);				// now have the algorithm have a go at it		dboTool.saturate(enol);				// now check wether it did the right thing		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond1.getOrder() + bond6.getOrder(), 0.00001); // around atom1		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond1.getOrder() + bond2.getOrder(), 0.00001); // around atom2		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond2.getOrder() + bond3.getOrder(), 0.00001); // around atom3		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond3.getOrder() + bond4.getOrder(), 0.00001); // around atom4		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond4.getOrder() + bond5.getOrder(), 0.00001); // around atom5		assertEquals(CDKConstants.BONDORDER_SINGLE + CDKConstants.BONDORDER_DOUBLE, 				bond5.getOrder() + bond6.getOrder(), 0.00001); // around atom6	}		private void addHydrogens(IAtomContainer container, IAtom atom, int numberOfHydrogens) {		for (int i=0; i<numberOfHydrogens; i++) 			container.addBond(atom.getBuilder().newBond(atom, atom.getBuilder().newAtom("H")));	}	}

⌨️ 快捷键说明

复制代码Ctrl + C
搜索代码Ctrl + F
全屏模式F11
增大字号Ctrl + =
减小字号Ctrl + -
显示快捷键?