dotwriter.py

来自「The library is a C++/Python implementati」· Python 代码 · 共 399 行

PY
399
字号
# -*- coding: iso-8859-1 -*-## This file is a part of the Bayes Blocks library## Copyright (C) 2001-2006 Markus Harva, Antti Honkela, Alexander# Ilin, Tapani Raiko, Harri Valpola and Tomas 謘tman.## This program is free software; you can redistribute it and/or modify# it under the terms of the GNU General Public License as published by# the Free Software Foundation; either version 2, or (at your option)# any later version.## This program is distributed in the hope that it will be useful,# but WITHOUT ANY WARRANTY; without even the implied warranty of# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the# GNU General Public License (included in file License.txt in the# program package) for more details.## $Id: DotWriter.py 7 2006-10-26 10:26:41Z ah $#"""Convert the BB network to dot source code"""from __future__ import nested_scopesimport bblocks.Label as Labelimport bblocks.Helpers as Helpersimport copyimport stringimport osimport os.path# All node types supported by Bayes Blocks librarynodetypes = [    "Constant",    "ConstantV",    "Prod",    "ProdV",    "Sum2",    "Sum2V",    "SumN",    "SumNV",    "Rectification",    "RectificationV",    "DelayV",    "Gaussian",    "GaussianV",    "DelayGaussV",    "SparseGaussV",    "RectifiedGaussian",    "RectifiedGaussianV",    "GaussRect",    "GaussRectV",    "GaussNonlin",    "GaussNonlinV",    "MoG",    "MoGV",    "Discrete",    "DiscreteV",    "DiscreteDirichlet",    "DiscreteDirichletV",    "Dirichlet",    "Proxy",    "Relay",    "Evidence",    "EvidenceV",    "Memory",    "OLDelayS",    "OLDelayD",    ]# Node types representing variablesvariables = [    "Gaussian",    "GaussianV",    "DelayGaussV",    "SparseGaussV",    "RectifiedGaussian",    "RectifiedGaussianV",    "GaussRect",    "GaussRectV",    "GaussNonlin",    "GaussNonlinV",    "MoG",    "MoGV",    "Discrete",    "DiscreteV",    "DiscreteDirichlet",    "DiscreteDirichletV",    "Dirichlet",    ]# Possible node propertiesall_properties = {'shape': ['ellipse', 'box'],                  'style': ['plain', 'bold', 'filled'],                  'peripheries': [1, 2, 3, 4, 5, 6, 7, 8, 9, 10]}class NodeProperties:    """A class to represent visual node properties supported by dot"""    def __init__(self, shape='ellipse', style='plain', color='#000000',                 fillcolor='#bebebe', peripheries=1):        self.SetShape(shape)        self.SetStyle(style)        self.SetColor(color)        self.SetFillcolor(fillcolor)        self.SetPeripheries(peripheries)    def SetShape(self, shape):        if shape not in all_properties['shape']:            raise ValueError('Invalid shape')        self.shape = shape    def SetStyle(self, style):        if style not in all_properties['style']:            raise ValueError('Invalid style')        self.style = style    def SetColor(self, color):        self.color = color    def SetFillcolor(self, color):        self.fillcolor = color    def SetPeripheries(self, peripheries):        self.peripheries = peripheries    def SetAll(self, propd):        """Set all properties to values defined in given dictionary"""        self.SetShape(propd['shape'])        self.SetStyle(propd['style'])        self.SetPeripheries(propd['peripheries'])        self.SetColor(propd['color'])        self.SetFillcolor(propd['fillcolor'])    def PropertyDict(self):        """Return the values of the properties in a dictionary"""        return {'shape': self.shape,                'style': self.style,                'peripheries': self.peripheries,                'color': self.color,                'fillcolor': self.fillcolor}    def PropertyString(self):        """Return a string of dot source code with the specified properties"""        components = []        if self.shape != 'ellipse':            components.append('shape=%s' % self.shape)        if self.style not in ['', 'plain']:            components.append('style=%s' % self.style)        if self.color != '#000000':            components.append('color="%s"' % self.color)        if self.fillcolor != '#bebebe':            components.append('fillcolor="%s"' % self.fillcolor)        if self.peripheries != 1:            components.append('peripheries=%d' % self.peripheries)        if len(components) == 0:            return ''        else:            return '[' + string.join(components, ',') + ']'# Default properties for different node typesnodeproperties = {}for n in nodetypes:    prop = NodeProperties()    if n.endswith("V"):        prop.SetStyle("bold")    if n.startswith("Discrete"):        prop.SetShape("box")    if n.startswith("Evidence"):        prop.SetColor("#bebebe")    nodeproperties[n] = propclass PlainWriter:    """BBNet to dot source converter with network modification properties"""    def __init__(self, net):        """Create a writer for the given network (Net or PyNet)"""        self.net = net        self.net.SortNodes()        # Create an auxiliary representation of the network        self.d = {}        for i in range(self.net.NodeCount()):            node = self.net.GetNodeByIndex(i)            l = [node.GetType(), []]            j = 0            p = node.GetParent(j)            while p:                l[1].append(p.GetLabel())                j += 1                p = node.GetParent(j)            self.d[node.GetLabel()] = l        # Make an active copy of the representation for modification        self.d_act = copy.deepcopy(self.d)        # Node visual properties specified by label        self.specpropsauto = {}        self.specpropsmanual = {}        # Get a list of node types in the network and add new ones to        # the default list        self.types = copy.deepcopy(nodetypes)        self.properties = copy.deepcopy(nodeproperties)        self.variables = copy.deepcopy(variables)        for n in self.d.keys():            if self.d[n][0] not in self.types:                self.types.append(self.d[n][0])                self.properties[self.d[n][0]] = NodeProperties()                if self.net.GetVariable(n) is not None:                    self.variables.append(self.d[n][0])        # Number of last indices to drop by label stem        self.indexdrops = {}        # Drop all indices?        self.dropall = 0    def WriteGraph(self, f):        """Write the current representation to a dot source file"""        if type(f) == type('str'):            f = open(f, 'w')        f.write("// This file was automatically generated by Bayes Blocks Visualiser\n")        f.write("digraph G {\n")        for n in self.d_act.keys():            if self.specpropsmanual.has_key(n):                f.write("    \"" + n + "\" " +                        self.specpropsmanual[n].PropertyString() +                        ";\n")            elif self.specpropsauto.has_key(n):                f.write("    \"" + n + "\" " +                        self.specpropsauto[n].PropertyString() +                        ";\n")            else:                f.write("    \"" + n + "\" " +                        self.properties[self.d_act[n][0]].PropertyString() +                        ";\n")            for p in self.d_act[n][1]:                f.write("    \"" + p + "\" -> \"" + n + "\";\n")        f.write("}\n")        f.close()    def WriteToTk(self, fname):        """Write a graph and convert it to Tk source using dot and fig2dev"""        f = open(fname, 'w')        (pin, pout) = os.popen2('dot -Tfig | fig2dev -Ltk')        self.WriteGraph(pin)        for line in pout.readlines():            f.write(line)        pout.close()        f.close()    def ResetFilter(self):        """Restore the working copy to be equal to the original"""        self.dropall = 0        self.specpropsauto = {}        self.d_act = copy.deepcopy(self.d)    def FilterType(self, type):        """Remove all nodes of given types (list) from the graph"""        removed = []        for n in self.d_act.keys():            if self.d_act[n][0] in type:                removed.append(n)                del self.d_act[n]        for n in self.d_act.keys():            self.d_act[n][1] = filter(                lambda x: x not in removed, self.d_act[n][1])    def FilterButType(self, type):        """Remove nodes of all but given types (list) from the graph"""        removed = []        for n in self.d_act.keys():            if self.d_act[n][0] not in type:                removed.append(n)        for r in removed:            for n in self.d_act.keys():                if r in self.d_act[n][1]:                    self.d_act[n][1] = filter(lambda x: x != r,                                              self.d_act[n][1])                    self.d_act[n][1] += self.d_act[r][1]            del self.d_act[r]    def FilterConst(self):        """Remove constant nodes"""        self.FilterType(['Constant', 'ConstantV'])    def FilterEvidence(self):        """Remove evidence nodes"""        self.FilterType(['Evidence', 'EvidenceV'])    def CombineSumtrees(self):        """Hide the internal structure of sum trees by combining them to        a single node"""        # Phase 1: Find all Sum2(V) nodes        s = []        for n in self.d_act.keys():            if (self.d_act[n][0] in ['Sum2', 'Sum2V']):                s.append(n)        # Phase 2: Remove all that are not roots of sum trees        l = s        for n in s:            l = filter(lambda x: x not in self.d_act[n][1], l)        # Phase 3: Combine all other nodes in given tree with the root        for n in l:            parents = self.d_act[n][1]            k = 0            while k < len(parents):                if not self.d_act.has_key(parents[k]):                    del parents[k]                elif (self.d_act[parents[k]][0] in ['Sum2', 'Sum2V']):                    parents += self.d_act[parents[k]][1]                    del self.d_act[parents[k]]                    del parents[k]                else:                    k += 1            parents.sort()            parents = Helpers.Unique(parents)            self.d_act[n] = [self.d_act[n][0], parents]    def DropIndices(self):        """Drop all indices from labels"""        # Phase 1: Drop all indices, combine nodes when necessary        d = {}        for n in self.d_act.keys():            stem, inds = Label.Unlabel(n)            if d.has_key(stem):                d[stem][1] += map(                    lambda x: Label.Unlabel(x)[0], self.d_act[n][1])            else:                if len(inds) > 0:                    # Add peripheries to show indices are being dropped                    self.specpropsauto[stem] = copy.deepcopy(                        self.properties[self.d_act[n][0]])                    self.specpropsauto[stem].SetPeripheries(len(inds) + 1)                d[stem] = [self.d_act[n][0], map(                    lambda x: Label.Unlabel(x)[0], self.d_act[n][1])]                # Phase 2: Cleanup by removing possible duplicate parents        for n in d.keys():            d[n][1].sort()            d[n][1] = Helpers.Unique(d[n][1])        self.d_act = d        self.dropall = 1    def GetAllLabels(self):        """Return a dictionary with all occurring label stems and numbers        of indices in the corresponding labels"""        d = {}        if self.dropall:            for n in self.d_act.keys():                stem, inds = Label.Unlabel(n)                if not d.has_key(stem):                    if self.specpropsauto.has_key(stem):                        d[stem] = len(inds) + self.indexdrops.get(stem, 0) + \                                  self.specpropsauto[stem].peripheries - 1                    else:                        d[stem] = len(inds) + self.indexdrops.get(stem, 0)        else:            for n in self.d_act.keys():                stem, inds = Label.Unlabel(n)                if not d.has_key(stem):                    d[stem] = len(inds) + self.indexdrops.get(stem, 0)        return d    def TruncateLabel(self, label):        """Drop the extra indices from the end of given label according        to the preset list of what to drop"""        stem, inds = Label.Unlabel(label)        if self.indexdrops.has_key(stem) and self.indexdrops[stem] > 0:            label = Label.Label(stem, inds[:-self.indexdrops[stem]])        return label    def SelectivelyDropIndices(self):        """Selectively drop indices from the labels"""        # Phase 0: check whether we are needed at all        need_to_run = 0        for n in self.indexdrops.keys():            if self.indexdrops[n] > 0:                need_to_run = 1                break        if not need_to_run:            return        d = {}        # Phase 1: drop indices from dictionary keys and combine items        for n in self.d_act.keys():            newlabel = self.TruncateLabel(n)            if d.has_key(newlabel):                d[newlabel][1] += self.d_act[n][1]            else:                d[newlabel] = self.d_act[n]        # Phase 2: drop indices from lists in dictionary        for n in d.keys():            d[n][1] = map(self.TruncateLabel, d[n][1])            d[n][1].sort()            d[n][1] = Helpers.Unique(d[n][1])        self.d_act = d

⌨️ 快捷键说明

复制代码Ctrl + C
搜索代码Ctrl + F
全屏模式F11
增大字号Ctrl + =
减小字号Ctrl + -
显示快捷键?