nativemediaplayerwindowsds.java

来自「编辑视频文件」· Java 代码 · 共 1,613 行 · 第 1/4 页

JAVA
1,613
字号
                                fileSourceOutputPinInfo.disconnect();                            }                        }                        break;                    }                }                */            // we have the file source filter output pin and the default filters, connect everything            IPinInfoImpl pinInfoIn = new IPinInfoImpl();            IPinInfoImpl pinInfoOut = new IPinInfoImpl();            // connect the file source to the default splitter's input pin            IDispatch pinDisp = defaultSplitterFI.findPin(new BStr("Input"));            pinDisp.queryInterface(pinInfoIn.getIID(), pinInfoIn);            fileSourceOutputPinInfo.connect(pinInfoIn);            System.out.println("Filter: " +                defaultSplitterFI.getName().getValue() + " In: " +                pinInfoIn.getName().getValue());            // check which output pins are available            // direction == 0 means input, direction == 1 means output            defaultSplitterFI.getPins().queryInterface(splitterPinColl.getIID(),                splitterPinColl);            long outCount = splitterPinColl.getCount().getValue();            for (int i = 0; i < outCount; i++) {                splitterPinColl.item(new Int32(i)).queryInterface(pinInfo.getIID(),                    pinInfo);                if (pinInfo.getDirection().getValue() == 0) {                    continue;                }                if (pinInfo.getName().getValue().equals("Video")) {                    System.out.println("Filter: " +                        defaultSplitterFI.getName().getValue() + " Pin: " +                        pinInfo.getName().getValue() + " - " +                        pinInfo.getDirection().getValue());                    //handle the video chain, item 0 = in, item 1 = out                    videoDecoderFI.getPins().queryInterface(pinColl.getIID(),                        pinColl);                    pinColl.item(new Int32(0)).queryInterface(pinInfoIn.getIID(),                        pinInfoIn);                    System.out.println("Filter: " +                        videoDecoderFI.getName().getValue() + " Pin: " +                        pinInfoIn.getName().getValue() + " - " +                        pinInfoIn.getDirection().getValue());                    pinInfo.connect(pinInfoIn);                    //pinInfo.render();                    pinColl.item(new Int32(1)).queryInterface(pinInfoOut.getIID(),                        pinInfoOut);                    System.out.println("Filter: " +                        videoDecoderFI.getName().getValue() + " Pin: " +                        pinInfoOut.getName().getValue() + " - " +                        pinInfoOut.getDirection().getValue());                    videoRendererFI.getPins().queryInterface(pinColl.getIID(),                        pinColl);                    pinColl.item(new Int32(0)).queryInterface(pinInfoIn.getIID(),                        pinInfoIn);                    System.out.println("Filter: " +                        videoRendererFI.getName().getValue() + " Pin: " +                        pinInfoIn.getName().getValue() + " - " +                        pinInfoIn.getDirection().getValue());                    pinInfoOut.connect(pinInfoIn);                } else if (pinInfo.getName().getValue().equals("Audio")) {                    // handle the audio chain                    System.out.println("Filter: " +                        defaultSplitterFI.getName().getValue() + " Pin: " +                        pinInfo.getName().getValue() + " - " +                        pinInfo.getDirection().getValue());                    audioDecoderFI.getPins().queryInterface(pinColl.getIID(),                        pinColl);                    pinColl.item(new Int32(0)).queryInterface(pinInfoIn.getIID(),                        pinInfoIn);                    System.out.println("Filter: " +                        audioDecoderFI.getName().getValue() + " Pin: " +                        pinInfoIn.getName().getValue() + " - " +                        pinInfoIn.getDirection().getValue());                    pinInfo.connect(pinInfoIn);                    pinColl.item(new Int32(1)).queryInterface(pinInfoOut.getIID(),                        pinInfoOut);                    System.out.println("Filter: " +                        audioDecoderFI.getName().getValue() + " Pin: " +                        pinInfoOut.getName().getValue() + " - " +                        pinInfoOut.getDirection().getValue());                    audioRendererFI.getPins().queryInterface(pinColl.getIID(),                        pinColl);                    pinColl.item(new Int32(0)).queryInterface(pinInfoIn.getIID(),                        pinInfoIn);                    System.out.println("Filter: " +                        audioRendererFI.getName().getValue() + " Pin: " +                        pinInfoIn.getName().getValue() + " - " +                        pinInfoIn.getDirection().getValue());                    pinInfoOut.connect(pinInfoIn);                }            }            // recreate objects, in case of new mediaControl	                    final IMediaPositionImpl mp = new IMediaPositionImpl();            mediaControl.queryInterface(mp.getIID(), mp);            mediaPosition = mp;            final IVideoWindowImpl vw = new IVideoWindowImpl();            mediaControl.queryInterface(vw.getIID(), vw);            videoWindow = vw;            final IBasicVideo2Impl bv = new IBasicVideo2Impl();            mediaControl.queryInterface(bv.getIID(), bv);            basicVideo = bv;            final IBasicAudioImpl ba = new IBasicAudioImpl();            mediaControl.queryInterface(ba.getIID(), ba);            basicAudio = ba;            final IMediaEventExImpl me = new IMediaEventExImpl();            mediaControl.queryInterface(me.getIID(), me);            mediaEvent = me;        } catch (ComException comex) {            // restore old structure            System.out.println("Could not create default filter graph: " +                comex.getMessage());            comex.printStackTrace();        } catch (Exception ex) {            System.out.println("Any error: " + ex.getMessage());            ex.printStackTrace();        }    }    /**     * DOCUMENT ME!     *     * @return DOCUMENT ME!     */    public MediaDescriptor getMediaDescriptor() {        return mediaDescriptor;    }    /**     *     */    public String getFrameworkDescription() {        return "Native Windows Media Framework DS01";    }    /**     * Should be removed from interface?     *     * @param event DOCUMENT ME!     */    public synchronized void controllerUpdate(ControllerEvent event) {    }    /**     * Gets the display Component for this Player.     *     * @return DOCUMENT ME!     */    public java.awt.Component getVisualComponent() {        return visualComponent;    }    /**     * @see mpi.eudico.client.annotator.player.ElanMediaPlayer#getSourceHeight()     */    public int getSourceHeight() {        if (basicVideo != null) {            return (int) basicVideo.getSourceHeight().getValue();        }        return 0;    }    /**     * @see mpi.eudico.client.annotator.player.ElanMediaPlayer#getSourceWidth()     */    public int getSourceWidth() {        if (basicVideo != null) {            return (int) basicVideo.getSourceWidth().getValue();        }        return 0;    }    /**     * Gets the aspectRatio between width and height of the video image     *     * @return DOCUMENT ME!     */    public float getAspectRatio() {        return aspectRatio;    }    /**     *     */    public synchronized void playInterval(long startTime, long stopTime) {        // Setting stoptime BEFORE setting media time is important when rendering .wav        // This sucks and there is no real explanation for it        setStopTime(stopTime);        setMediaTime(startTime);        start();    }    /**     * Sets the time where the player and all its slaves should automaticaly     * stop playing A correction is made for stop time on a frame boundary. In     * the pause mode the correct (new) frame is shown when media time is set     * to the frame boundary but stopping at the frame boundary does not     * render the correct frame.     *     * @param stopTime DOCUMENT ME!     */    public void setStopTime(long stopTime) {        this.stopTime = stopTime;        // see if the stop time must be increased to ensure correct frame rendering at a frame boundary        long nFrames = (stopTime + offset) / getMilliSecondsPerSample();        long extra = 0;        if ((nFrames * getMilliSecondsPerSample()) == (stopTime + offset)) { // on a frame boundary            extra = 1;            this.stopTime += 1;        }        mediaPosition.setStopTime(new DoubleFloat(                ((float) stopTime + offset + extra) / 1000));        setControllersStopTime(stopTime);    }    /**     * Starts the Player as soon as possible. is not synchronized in JMF     */    public synchronized void start() {        if (playing) {            return;        }        // play at start of media if at end of media        if ((getMediaDuration() - getMediaTime()) < 40) {            setMediaTime(0);        }        playing = true;        mediaControl.run();        // make sure all managed controllers are started        startControllers();        // temporary polling for player state, will be obsolete when active callback is available        Thread tw = new Thread(new PlayerStateWatcher());        //		tw.setPriority(Thread.MIN_PRIORITY);        tw.start();    }    /**     * Stop the media player     */    public synchronized void stop() {        if (!playing) {            return;        }        mediaControl.pause();        stopControllers();        setControllersMediaTime(getMediaTime());        playing = false;    }    /* DISABLED BLOCK WITH EXPERIMENTAL ACTIVE CALLBACK CODE       private class CallbackWindowProc extends WindowProc {           //public CallbackWindowProc(Wnd window) {           //    super(window);           //}           public void callback() {               System.out.println("filter graph message: " + (int)_msg.getValue());               switch ((int)_msg.getValue()) {                   case 10:                       break;                   default:                       break;               }           }       }       private static class ListenerWindow extends Wnd {           public ListenerWindow(Component component) {               super(component);           }           public static void eventLoop(long event) {               System.out.println("event: " + event);           }       }     */    /**     * Tell if this player is playing     *     * @return DOCUMENT ME!     */    public boolean isPlaying() {        return playing;    }    /**     * DOCUMENT ME!     *     * @return the step size for one frame     */    public long getMilliSecondsPerSample() {        return (long) millisPerSample;    }    /**     * DOCUMENT ME!     *     * @param milliSeconds the step size for one frame     */    public void setMilliSecondsPerSample(long milliSeconds) {        // disabled because this player knows itself better        //millisPerSample = milliSeconds;        if (!frameRateAutoDetected) {            millisPerSample = milliSeconds;        }    }    /**     * Gets the volume as a number between 0 and 1     *     * @return DOCUMENT ME!     */    public float getVolume() {        // should do something more logarithmic?        try {            Int32 volume = basicAudio.getVolume();            return ((float) volume.getValue() + 10000) / 10000;        } catch (Exception e) {            return 1.0f;            // do nothing here, The empty try catch might solve problems that occurred            // on some clients when saving the volume during exit in ELAN 2.3        }    }    /**     * Gets the volume as a number between 0 and 1     *     * @param level DOCUMENT ME!     */    public void setVolume(float level) {        try {            // should do something more logarithmic?            basicAudio.setVolume(new Int32((int) ((level * 10000) - 10000)));        } catch (Exception e) {            // video without audio gives a problem when not catched            // e.printStackTrace();        }    }    /**     * Set the offset to be used in get and set media time for this player     *     * @param offset the offset in milli seconds     */    public void setOffset(long offset) {        this.offset = offset;        mediaDescriptor.timeOrigin = offset;        duration = (long) (1000 * mediaPosition.getDuration().getValue()) -            offset;        stopTime = duration;    }    /**     * DOCUMENT ME!     *     * @return the offset used by this player     */    public long getOffset() {        return offset;    }    /**     * Sets the Clock's media time in milli seconds. is not synchronized in JMF     *     * @param time DOCUMENT ME!     */    public synchronized void setMediaTime(long time) {        // the player must be in state 1(pause) when immediate rendering after set media time is required.        if (mediaControl.getState(new Int32(0)).getValue() != STATE_PAUSE) {            mediaControl.pause();        }

⌨️ 快捷键说明

复制代码Ctrl + C
搜索代码Ctrl + F
全屏模式F11
增大字号Ctrl + =
减小字号Ctrl + -
显示快捷键?